beth658 beth658

02-10-2017
Physics

contestada

When experimenting, you purposely change the temperature, temperature is the ___ variable?

Respuesta :

JonHenderson55 JonHenderson55

02-10-2017

Answer: "independent" .
______________________________

Answer Link

Otras preguntas

whats the squareroot of 98

Match the banking term with its definition.A. List currency coin and checks deposits into an accountB. A document signed by the depositor instructing the bank

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

Write a Java program to compute the sum of the upper-rounded value of the number 4.2 and the square of 25. Display all the three values to the user on different

Which word does the author use that he believes the spaceship metaphor is incorrect

songs for East Africa's association officials

Which kind of cells do plants and animals have?

Find the value of b.

PLZ HELPPPPPP. A store sells books for $12 each. In the proportional relationship between x, the number of books purchased, and y, the cost per books in dollars

Griggs Co. failed to amortize the premium on an outstanding five-year bond issue. What is the resulting effect on interest expense and the bond outstanding bala