Seudónimo Seudónimo
  • 01-12-2014
  • Mathematics
contestada

what is the Nth term of 0 3 8 15 24 35

Respuesta :

Airplanenerd777 Airplanenerd777
  • 01-12-2014
difference = 3,5,7,9,11...
2nd difference = 2
difference = (2n+1)
gradient = 2n
integral of 2n = n^2.
n^2 = 1,4,9...
n^2 - 1

Answer Link

Otras preguntas

What is 82101 divided by 4
Find the compound interest and the interest earned when given investment has continuous compounding 11000 at 2.3% for 8 years
please please help me
Which word out of these:( behave hold kill amuse turn give) would fit this sentence “Mother, a man’s been _____ ,”began Laura
All of it please!!!!!!!
» What is the product? 0.9 x 100 =
k2=225 A) k=13 B) k=(-13) C) k=15 D) k=(-15)
Where did imperialism happen
3x + 9y ≥ 18 2x + 4y ≥ 10 3x + y ≥ 5 x ≥ 0, y ≥ 0
cosec(6b+pi/8)=sec(2b-pi/8)​