Seudónimo Seudónimo
  • 04-04-2019
  • Mathematics
contestada

please help me can anyone solve this what is x^2+5x-7?​

Respuesta :

chikafujiwara
chikafujiwara chikafujiwara
  • 04-04-2019

Answer:

x = (-5+-sqrt(53))/2

Step-by-step explanation:

Apply the quadratic formula to this equation with a = 1, b = 5, and c = -7.

Plug it in then simplify.

Quadratic formula is x = (-b+-sqrt(b^2-4ac))/2a

Answer Link

Otras preguntas

When cognitive psychologists talk about the process of "putting" things in memory, they often use the term:?
which of the these terms refers to a place where water is available in the desert
Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)
Explain in terms of atoms why ch3ch2oh and ch3cho are not isomers of each other
Find x in the triangles
What are elements of plot structure that the reader can study in order to understand the resolution
What is the median of the data set 10, 7, 9, 9, 4, 6?
What is the missing reason in the proof
Someone please help me ?
is the answer a, b, c, or d.